C15H13N3O8S — CID 100539643
2-(N-(2-methyl-5-nitrophenyl)sulfonyl-3-nitroanilino)acetic acid (PubChem CID 100539643) has the molecular formula C15H13N3O8S and a molecular weight of 395.35 g/mol. Its IUPAC name is 2-(N-(2-methyl-5-nitrophenyl)sulfonyl-3-nitroanilino)acetic acid.
| Compound Name | 2-(N-(2-methyl-5-nitrophenyl)sulfonyl-3-nitroanilino)acetic acid |
|---|---|
| PubChem CID | 100539643 |
| Molecular Formula | C15H13N3O8S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-(N-(2-methyl-5-nitrophenyl)sulfonyl-3-nitroanilino)acetic acid |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(CC(=O)O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13N3O8S/c1-10-5-6-13(18(23)24)8-14(10)27(25,26)16(9-15(19)20)11-3-2-4-12(7-11)17(21)22/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | GDKITKUQRDKFME-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|