C17H16N2O7S — CID 50894463
2-(N-(3-nitrophenyl)sulfonyl-3-prop-2-enoxyanilino)acetic acid (PubChem CID 50894463) has the molecular formula C17H16N2O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-(N-(3-nitrophenyl)sulfonyl-3-prop-2-enoxyanilino)acetic acid.
| Compound Name | 2-(N-(3-nitrophenyl)sulfonyl-3-prop-2-enoxyanilino)acetic acid |
|---|---|
| PubChem CID | 50894463 |
| Molecular Formula | C17H16N2O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-(N-(3-nitrophenyl)sulfonyl-3-prop-2-enoxyanilino)acetic acid |
| SMILES | C=CCOc1cccc(N(CC(=O)O)S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H16N2O7S/c1-2-9-26-15-7-3-5-13(10-15)18(12-17(20)21)27(24,25)16-8-4-6-14(11-16)19(22)23/h2-8,10-11H,1,9,12H2,(H,20,21) |
| InChIKey | HQDLULJFBZZFQY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|