C18H15ClFN3O4S — CID 24662805
2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide (PubChem CID 24662805) has the molecular formula C18H15ClFN3O4S and a molecular weight of 423.85 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 24662805 |
| Molecular Formula | C18H15ClFN3O4S |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)nc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15ClFN3O4S/c19-17-8-7-16(10-21-17)28(25,26)23(11-15-2-1-9-27-15)12-18(24)22-14-5-3-13(20)4-6-14/h1-10H,11-12H2,(H,22,24) |
| InChIKey | MGFUNRCZOFQDMA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|