C14H13ClF3N3O4S — CID 24662826
2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 24662826) has the molecular formula C14H13ClF3N3O4S and a molecular weight of 411.79 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 24662826 |
| Molecular Formula | C14H13ClF3N3O4S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)nc1)NCC(F)(F)F |
| InChI | InChI=1S/C14H13ClF3N3O4S/c15-12-4-3-11(6-19-12)26(23,24)21(7-10-2-1-5-25-10)8-13(22)20-9-14(16,17)18/h1-6H,7-9H2,(H,20,22) |
| InChIKey | NNTHJKRRYRBZOH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|