C19H17Cl2N3O4S — CID 24653295
N-[(2-chlorophenyl)methyl]-2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide (PubChem CID 24653295) has the molecular formula C19H17Cl2N3O4S and a molecular weight of 454.34 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 24653295 |
| Molecular Formula | C19H17Cl2N3O4S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)nc1)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O4S/c20-17-6-2-1-4-14(17)10-23-19(25)13-24(12-15-5-3-9-28-15)29(26,27)16-7-8-18(21)22-11-16/h1-9,11H,10,12-13H2,(H,23,25) |
| InChIKey | FHXNXEUGBJDICJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|