C18H14ClF2N3O4S — CID 24653292
2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide (PubChem CID 24653292) has the molecular formula C18H14ClF2N3O4S and a molecular weight of 441.84 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 24653292 |
| Molecular Formula | C18H14ClF2N3O4S |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)sulfonyl-(furan-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(CN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)nc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H14ClF2N3O4S/c19-17-6-4-14(9-22-17)29(26,27)24(10-13-2-1-7-28-13)11-18(25)23-12-3-5-15(20)16(21)8-12/h1-9H,10-11H2,(H,23,25) |
| InChIKey | AUKODHBYLVIFCH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|