C15H15FN2O3 — CID 113161076
2-[acetyl(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide (PubChem CID 113161076) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 2-[acetyl(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[acetyl(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113161076 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[acetyl(furan-2-ylmethyl)amino]-N-(4-fluorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C15H15FN2O3/c1-11(19)18(9-14-3-2-8-21-14)10-15(20)17-13-6-4-12(16)5-7-13/h2-8H,9-10H2,1H3,(H,17,20) |
| InChIKey | IKHPVBYEMVLYHC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |