C20H16BrFN2O3 — CID 4779798
N-[2-(2-bromoanilino)-2-oxoethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide (PubChem CID 4779798) has the molecular formula C20H16BrFN2O3 and a molecular weight of 431.26 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4779798 |
| Molecular Formula | C20H16BrFN2O3 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(CN(Cc1ccco1)C(=O)c1ccc(F)cc1)Nc1ccccc1Br |
| InChI | InChI=1S/C20H16BrFN2O3/c21-17-5-1-2-6-18(17)23-19(25)13-24(12-16-4-3-11-27-16)20(26)14-7-9-15(22)10-8-14/h1-11H,12-13H2,(H,23,25) |
| InChIKey | ZCHCJBVWAHRCKC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |