C16H18BrN3O3 — CID 8620903
N-(2-bromophenyl)-2-[[2-[furan-2-ylmethyl(methyl)amino]acetyl]amino]acetamide (PubChem CID 8620903) has the molecular formula C16H18BrN3O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[2-[furan-2-ylmethyl(methyl)amino]acetyl]amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[2-[furan-2-ylmethyl(methyl)amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 8620903 |
| Molecular Formula | C16H18BrN3O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-(2-bromophenyl)-2-[[2-[furan-2-ylmethyl(methyl)amino]acetyl]amino]acetamide |
| SMILES | CN(CC(=O)NCC(=O)Nc1ccccc1Br)Cc1ccco1 |
| InChI | InChI=1S/C16H18BrN3O3/c1-20(10-12-5-4-8-23-12)11-16(22)18-9-15(21)19-14-7-3-2-6-13(14)17/h2-8H,9-11H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | GUWIXKLNXNXBFZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |