C13H13BrN2O2 — CID 2452076
N-(2-bromophenyl)-2-(furan-2-ylmethylamino)acetamide (PubChem CID 2452076) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(furan-2-ylmethylamino)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(furan-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 2452076 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-(2-bromophenyl)-2-(furan-2-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccco1)Nc1ccccc1Br |
| InChI | InChI=1S/C13H13BrN2O2/c14-11-5-1-2-6-12(11)16-13(17)9-15-8-10-4-3-7-18-10/h1-7,15H,8-9H2,(H,16,17) |
| InChIKey | KRRQLEJEJLTINZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |