C12H12BrN3O2 — CID 81177334
N-(2-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide (PubChem CID 81177334) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 81177334 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | N-(2-bromophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccon1)Nc1ccccc1Br |
| InChI | InChI=1S/C12H12BrN3O2/c13-10-3-1-2-4-11(10)15-12(17)8-14-7-9-5-6-18-16-9/h1-6,14H,7-8H2,(H,15,17) |
| InChIKey | KVHOGTGRNGOVHA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |