C12H11Cl2N3O2 — CID 81178095
N-(2,6-dichlorophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide (PubChem CID 81178095) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 81178095 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccon1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O2/c13-9-2-1-3-10(14)12(9)16-11(18)7-15-6-8-4-5-19-17-8/h1-5,15H,6-7H2,(H,16,18) |
| InChIKey | YISKQEJLZVDKDV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |