C18H22N2O3 — CID 113118081
3-[acetyl(furan-2-ylmethyl)amino]-N-(3,4-dimethylphenyl)propanamide (PubChem CID 113118081) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[acetyl(furan-2-ylmethyl)amino]-N-(3,4-dimethylphenyl)propanamide.
| Compound Name | 3-[acetyl(furan-2-ylmethyl)amino]-N-(3,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 113118081 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[acetyl(furan-2-ylmethyl)amino]-N-(3,4-dimethylphenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccc(C)c(C)c1)Cc1ccco1 |
| InChI | InChI=1S/C18H22N2O3/c1-13-6-7-16(11-14(13)2)19-18(22)8-9-20(15(3)21)12-17-5-4-10-23-17/h4-7,10-11H,8-9,12H2,1-3H3,(H,19,22) |
| InChIKey | FZGZRYCZDIRUJX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |