C18H22N2O3 — CID 113124484
3-(N-acetyl-3,4-dimethylanilino)-N-(furan-2-ylmethyl)propanamide (PubChem CID 113124484) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-(N-acetyl-3,4-dimethylanilino)-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-(N-acetyl-3,4-dimethylanilino)-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113124484 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-(N-acetyl-3,4-dimethylanilino)-N-(furan-2-ylmethyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)NCc1ccco1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-13-6-7-16(11-14(13)2)20(15(3)21)9-8-18(22)19-12-17-5-4-10-23-17/h4-7,10-11H,8-9,12H2,1-3H3,(H,19,22) |
| InChIKey | BHODRJWODDKOQZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |