C16H15F3N2O3 — CID 113135212
3-(N-acetyl-2,3,4-trifluoroanilino)-N-(furan-2-ylmethyl)propanamide (PubChem CID 113135212) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 3-(N-acetyl-2,3,4-trifluoroanilino)-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-(N-acetyl-2,3,4-trifluoroanilino)-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113135212 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(N-acetyl-2,3,4-trifluoroanilino)-N-(furan-2-ylmethyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)NCc1ccco1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H15F3N2O3/c1-10(22)21(13-5-4-12(17)15(18)16(13)19)7-6-14(23)20-9-11-3-2-8-24-11/h2-5,8H,6-7,9H2,1H3,(H,20,23) |
| InChIKey | SUXDQXQZYPRJMJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|