C16H17NO4 — CID 82321480
3-[N-(furan-2-carbonyl)-3,4-dimethylanilino]propanoic acid (PubChem CID 82321480) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-[N-(furan-2-carbonyl)-3,4-dimethylanilino]propanoic acid.
| Compound Name | 3-[N-(furan-2-carbonyl)-3,4-dimethylanilino]propanoic acid |
|---|---|
| PubChem CID | 82321480 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-[N-(furan-2-carbonyl)-3,4-dimethylanilino]propanoic acid |
| SMILES | Cc1ccc(N(CCC(=O)O)C(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C16H17NO4/c1-11-5-6-13(10-12(11)2)17(8-7-15(18)19)16(20)14-4-3-9-21-14/h3-6,9-10H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | WXBYXENBXQLDBB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |