C22H20Cl2N2O4 — CID 42726275
N-[3-[(2,2-dichloroacetyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide (PubChem CID 42726275) has the molecular formula C22H20Cl2N2O4 and a molecular weight of 447.32 g/mol. Its IUPAC name is N-[3-[(2,2-dichloroacetyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide.
| Compound Name | N-[3-[(2,2-dichloroacetyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42726275 |
| Molecular Formula | C22H20Cl2N2O4 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[3-[(2,2-dichloroacetyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide |
| SMILES | O=C(NCCCN(C(=O)c1ccco1)c1ccc(Oc2ccccc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C22H20Cl2N2O4/c23-20(24)21(27)25-13-5-14-26(22(28)19-8-4-15-29-19)16-9-11-18(12-10-16)30-17-6-2-1-3-7-17/h1-4,6-12,15,20H,5,13-14H2,(H,25,27) |
| InChIKey | MCLYZOPKYXYMPA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|