C21H20N2O4 — CID 113062542
N-[2-(N-acetyl-4-phenoxyanilino)ethyl]furan-2-carboxamide (PubChem CID 113062542) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[2-(N-acetyl-4-phenoxyanilino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2-(N-acetyl-4-phenoxyanilino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113062542 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[2-(N-acetyl-4-phenoxyanilino)ethyl]furan-2-carboxamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccco1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-16(24)23(14-13-22-21(25)20-8-5-15-26-20)17-9-11-19(12-10-17)27-18-6-3-2-4-7-18/h2-12,15H,13-14H2,1H3,(H,22,25) |
| InChIKey | BDSQLSXHDSESQC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |