C27H23ClN2O4 — CID 42726086
N-[3-[(4-chlorobenzoyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide (PubChem CID 42726086) has the molecular formula C27H23ClN2O4 and a molecular weight of 474.94 g/mol. Its IUPAC name is N-[3-[(4-chlorobenzoyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide.
| Compound Name | N-[3-[(4-chlorobenzoyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42726086 |
| Molecular Formula | C27H23ClN2O4 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[3-[(4-chlorobenzoyl)amino]propyl]-N-(4-phenoxyphenyl)furan-2-carboxamide |
| SMILES | O=C(NCCCN(C(=O)c1ccco1)c1ccc(Oc2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClN2O4/c28-21-11-9-20(10-12-21)26(31)29-17-5-18-30(27(32)25-8-4-19-33-25)22-13-15-24(16-14-22)34-23-6-2-1-3-7-23/h1-4,6-16,19H,5,17-18H2,(H,29,31) |
| InChIKey | AATMPEYCWDZSCV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|