C18H19ClN2O5 — CID 113118132
methyl 3-[3-[acetyl(furan-2-ylmethyl)amino]propanoylamino]-4-chlorobenzoate (PubChem CID 113118132) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is methyl 3-[3-[acetyl(furan-2-ylmethyl)amino]propanoylamino]-4-chlorobenzoate.
| Compound Name | methyl 3-[3-[acetyl(furan-2-ylmethyl)amino]propanoylamino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 113118132 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl 3-[3-[acetyl(furan-2-ylmethyl)amino]propanoylamino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CCN(Cc2ccco2)C(C)=O)c1 |
| InChI | InChI=1S/C18H19ClN2O5/c1-12(22)21(11-14-4-3-9-26-14)8-7-17(23)20-16-10-13(18(24)25-2)5-6-15(16)19/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,23) |
| InChIKey | KQQNCILWFVBCQC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |