C16H15F3N2O3 — CID 113161103
2-[acetyl(furan-2-ylmethyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 113161103) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 2-[acetyl(furan-2-ylmethyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[acetyl(furan-2-ylmethyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113161103 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[acetyl(furan-2-ylmethyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(C(F)(F)F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-11(22)21(9-14-3-2-8-24-14)10-15(23)20-13-6-4-12(5-7-13)16(17,18)19/h2-8H,9-10H2,1H3,(H,20,23) |
| InChIKey | FTUYNJCNOGHHQM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |