C15H19F3N2O — CID 78787473
2-[ethyl(2-methylprop-2-enyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 78787473) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[ethyl(2-methylprop-2-enyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[ethyl(2-methylprop-2-enyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78787473 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[ethyl(2-methylprop-2-enyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=C(C)CN(CC)CC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O/c1-4-20(9-11(2)3)10-14(21)19-13-7-5-12(6-8-13)15(16,17)18/h5-8H,2,4,9-10H2,1,3H3,(H,19,21) |
| InChIKey | RQCKTXNOOFNTST-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|