C15H14Cl2N2O3 — CID 113161143
2-[acetyl(furan-2-ylmethyl)amino]-N-(2,6-dichlorophenyl)acetamide (PubChem CID 113161143) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 2-[acetyl(furan-2-ylmethyl)amino]-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-[acetyl(furan-2-ylmethyl)amino]-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 113161143 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[acetyl(furan-2-ylmethyl)amino]-N-(2,6-dichlorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1c(Cl)cccc1Cl)Cc1ccco1 |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-10(20)19(8-11-4-3-7-22-11)9-14(21)18-15-12(16)5-2-6-13(15)17/h2-7H,8-9H2,1H3,(H,18,21) |
| InChIKey | DECZVMPOYUFDNQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |