C20H18BrClN2O4S — CID 1315730
2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 1315730) has the molecular formula C20H18BrClN2O4S and a molecular weight of 497.80 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1315730 |
| Molecular Formula | C20H18BrClN2O4S |
| Molecular Weight | 497.80 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1ccc(Br)cc1)NCc1ccco1 |
| InChI | InChI=1S/C20H18BrClN2O4S/c21-16-5-9-19(10-6-16)29(26,27)24(13-15-3-7-17(22)8-4-15)14-20(25)23-12-18-2-1-11-28-18/h1-11H,12-14H2,(H,23,25) |
| InChIKey | KPZOXUWWZAVLIR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |