C17H22ClNO4S — CID 69466339
4-chloro-N-(furan-2-ylmethyl)-N-[(2S)-5-hydroxy-2-methylpentyl]benzenesulfonamide (PubChem CID 69466339) has the molecular formula C17H22ClNO4S and a molecular weight of 371.89 g/mol. Its IUPAC name is 4-chloro-N-(furan-2-ylmethyl)-N-[(2S)-5-hydroxy-2-methylpentyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(furan-2-ylmethyl)-N-[(2S)-5-hydroxy-2-methylpentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69466339 |
| Molecular Formula | C17H22ClNO4S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-chloro-N-(furan-2-ylmethyl)-N-[(2S)-5-hydroxy-2-methylpentyl]benzenesulfonamide |
| SMILES | C[C@@H](CCCO)CN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO4S/c1-14(4-2-10-20)12-19(13-16-5-3-11-23-16)24(21,22)17-8-6-15(18)7-9-17/h3,5-9,11,14,20H,2,4,10,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | HWPBMTIRBKFWBV-AWEZNQCLSA-N |
| XLogP | 3.53 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |