C13H18ClNO4S — CID 60829614
4-[(4-chlorophenyl)sulfonyl-propan-2-ylamino]butanoic acid (PubChem CID 60829614) has the molecular formula C13H18ClNO4S and a molecular weight of 319.81 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonyl-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(4-chlorophenyl)sulfonyl-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 60829614 |
| Molecular Formula | C13H18ClNO4S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonyl-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO4S/c1-10(2)15(9-3-4-13(16)17)20(18,19)12-7-5-11(14)6-8-12/h5-8,10H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | KMHFZGKXNAOWSH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |