C17H18ClNO4S — CID 50890002
4-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)butanoic acid (PubChem CID 50890002) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is 4-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)butanoic acid.
| Compound Name | 4-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 50890002 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)butanoic acid |
| SMILES | Cc1ccccc1N(CCCC(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-13-5-2-3-6-16(13)19(12-4-7-17(20)21)24(22,23)15-10-8-14(18)9-11-15/h2-3,5-6,8-11H,4,7,12H2,1H3,(H,20,21) |
| InChIKey | XIGYVNIGDOYQNA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |