C18H20ClNO4S — CID 50891763
4-(N-(4-chlorophenyl)sulfonyl-2,3-dimethylanilino)butanoic acid (PubChem CID 50891763) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is 4-(N-(4-chlorophenyl)sulfonyl-2,3-dimethylanilino)butanoic acid.
| Compound Name | 4-(N-(4-chlorophenyl)sulfonyl-2,3-dimethylanilino)butanoic acid |
|---|---|
| PubChem CID | 50891763 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-(N-(4-chlorophenyl)sulfonyl-2,3-dimethylanilino)butanoic acid |
| SMILES | Cc1cccc(N(CCCC(=O)O)S(=O)(=O)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C18H20ClNO4S/c1-13-5-3-6-17(14(13)2)20(12-4-7-18(21)22)25(23,24)16-10-8-15(19)9-11-16/h3,5-6,8-11H,4,7,12H2,1-2H3,(H,21,22) |
| InChIKey | SBVPDYAPLSPFEC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |