C18H20ClNO4S — CID 50893629
3-(N-(4-chlorophenyl)sulfonyl-2-propan-2-ylanilino)propanoic acid (PubChem CID 50893629) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is 3-(N-(4-chlorophenyl)sulfonyl-2-propan-2-ylanilino)propanoic acid.
| Compound Name | 3-(N-(4-chlorophenyl)sulfonyl-2-propan-2-ylanilino)propanoic acid |
|---|---|
| PubChem CID | 50893629 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-(N-(4-chlorophenyl)sulfonyl-2-propan-2-ylanilino)propanoic acid |
| SMILES | CC(C)c1ccccc1N(CCC(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-13(2)16-5-3-4-6-17(16)20(12-11-18(21)22)25(23,24)15-9-7-14(19)8-10-15/h3-10,13H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | IOQMNRCXSGJAED-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |