C18H20ClNO3S — CID 50893671
2-(N-(4-methylphenyl)sulfonyl-2-propan-2-ylanilino)acetyl chloride (PubChem CID 50893671) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is 2-(N-(4-methylphenyl)sulfonyl-2-propan-2-ylanilino)acetyl chloride.
| Compound Name | 2-(N-(4-methylphenyl)sulfonyl-2-propan-2-ylanilino)acetyl chloride |
|---|---|
| PubChem CID | 50893671 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-(N-(4-methylphenyl)sulfonyl-2-propan-2-ylanilino)acetyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Cl)c2ccccc2C(C)C)cc1 |
| InChI | InChI=1S/C18H20ClNO3S/c1-13(2)16-6-4-5-7-17(16)20(12-18(19)21)24(22,23)15-10-8-14(3)9-11-15/h4-11,13H,12H2,1-3H3 |
| InChIKey | ADGPWGZCYXSSFC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|