C15H12Cl3NO3S — CID 50892343
2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl chloride (PubChem CID 50892343) has the molecular formula C15H12Cl3NO3S and a molecular weight of 392.69 g/mol. Its IUPAC name is 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl chloride.
| Compound Name | 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl chloride |
|---|---|
| PubChem CID | 50892343 |
| Molecular Formula | C15H12Cl3NO3S |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)acetyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Cl)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl3NO3S/c1-10-5-7-11(8-6-10)23(21,22)19(9-14(17)20)13-4-2-3-12(16)15(13)18/h2-8H,9H2,1H3 |
| InChIKey | GLLJRMDYCCNRMI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|