C23H22Cl2N2O3S2 — CID 4694822
2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 4694822) has the molecular formula C23H22Cl2N2O3S2 and a molecular weight of 509.48 g/mol. Its IUPAC name is 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 4694822 |
| Molecular Formula | C23H22Cl2N2O3S2 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 2-(2,3-dichloro-N-(4-methylphenyl)sulfonylanilino)-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSc2ccccc2)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O3S2/c1-17-10-12-19(13-11-17)32(29,30)27(21-9-5-8-20(24)23(21)25)16-22(28)26-14-15-31-18-6-3-2-4-7-18/h2-13H,14-16H2,1H3,(H,26,28) |
| InChIKey | CGIDAPNQYCMROG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|