C16H14Cl2N2O5S — CID 50889512
2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetic acid (PubChem CID 50889512) has the molecular formula C16H14Cl2N2O5S and a molecular weight of 417.27 g/mol. Its IUPAC name is 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetic acid.
| Compound Name | 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetic acid |
|---|---|
| PubChem CID | 50889512 |
| Molecular Formula | C16H14Cl2N2O5S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(=O)O)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O5S/c1-10(21)19-11-5-7-12(8-6-11)26(24,25)20(9-15(22)23)14-4-2-3-13(17)16(14)18/h2-8H,9H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | INTWBTFSRMKXSR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |