C18H18Cl2N2O5S — CID 50889406
ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetate (PubChem CID 50889406) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetate.
| Compound Name | ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetate |
|---|---|
| PubChem CID | 50889406 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2,3-dichloroanilino)acetate |
| SMILES | CCOC(=O)CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O5S/c1-3-27-17(24)11-22(16-6-4-5-15(19)18(16)20)28(25,26)14-9-7-13(8-10-14)21-12(2)23/h4-10H,3,11H2,1-2H3,(H,21,23) |
| InChIKey | IYTPOAMBOMFUHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |