C19H21N3O7S — CID 100500698
ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2-methyl-3-nitroanilino)acetate (PubChem CID 100500698) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2-methyl-3-nitroanilino)acetate.
| Compound Name | ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2-methyl-3-nitroanilino)acetate |
|---|---|
| PubChem CID | 100500698 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | ethyl 2-(N-(4-acetamidophenyl)sulfonyl-2-methyl-3-nitroanilino)acetate |
| SMILES | CCOC(=O)CN(c1cccc([N+](=O)[O-])c1C)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C19H21N3O7S/c1-4-29-19(24)12-21(17-6-5-7-18(13(17)2)22(25)26)30(27,28)16-10-8-15(9-11-16)20-14(3)23/h5-11H,4,12H2,1-3H3,(H,20,23) |
| InChIKey | LJCOILVNSGVVFO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|