C18H20ClNO4S — CID 50895722
ethyl 2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate (PubChem CID 50895722) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is ethyl 2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate.
| Compound Name | ethyl 2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 50895722 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | ethyl 2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1cccc(Cl)c1C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-4-24-18(21)12-20(17-7-5-6-16(19)14(17)3)25(22,23)15-10-8-13(2)9-11-15/h5-11H,4,12H2,1-3H3 |
| InChIKey | FYUVUIQZCUKPNA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |