C17H17Cl2NO4S — CID 50892222
ethyl 2-(2,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate (PubChem CID 50892222) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is ethyl 2-(2,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate.
| Compound Name | ethyl 2-(2,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 50892222 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | ethyl 2-(2,4-dichloro-N-(4-methylphenyl)sulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-3-24-17(21)11-20(16-9-6-13(18)10-15(16)19)25(22,23)14-7-4-12(2)5-8-14/h4-10H,3,11H2,1-2H3 |
| InChIKey | FPRFCMAUFJUHSM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |