C16H14Cl3NO4S — CID 50892167
ethyl 2-(2,4-dichloro-N-(4-chlorophenyl)sulfonylanilino)acetate (PubChem CID 50892167) has the molecular formula C16H14Cl3NO4S and a molecular weight of 422.72 g/mol. Its IUPAC name is ethyl 2-(2,4-dichloro-N-(4-chlorophenyl)sulfonylanilino)acetate.
| Compound Name | ethyl 2-(2,4-dichloro-N-(4-chlorophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 50892167 |
| Molecular Formula | C16H14Cl3NO4S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | ethyl 2-(2,4-dichloro-N-(4-chlorophenyl)sulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3NO4S/c1-2-24-16(21)10-20(15-8-5-12(18)9-14(15)19)25(22,23)13-6-3-11(17)4-7-13/h3-9H,2,10H2,1H3 |
| InChIKey | VVNHZGCTMASBCO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |