C15H11Cl4NO4S — CID 50892663
methyl 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetate (PubChem CID 50892663) has the molecular formula C15H11Cl4NO4S and a molecular weight of 443.14 g/mol. Its IUPAC name is methyl 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetate.
| Compound Name | methyl 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetate |
|---|---|
| PubChem CID | 50892663 |
| Molecular Formula | C15H11Cl4NO4S |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | methyl 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl4NO4S/c1-24-15(21)8-20(13-5-3-9(16)6-12(13)19)25(22,23)14-7-10(17)2-4-11(14)18/h2-7H,8H2,1H3 |
| InChIKey | FAQJGOFZZALENI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |