C14H8Cl5NO3S — CID 50892681
2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetyl chloride (PubChem CID 50892681) has the molecular formula C14H8Cl5NO3S and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetyl chloride.
| Compound Name | 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetyl chloride |
|---|---|
| PubChem CID | 50892681 |
| Molecular Formula | C14H8Cl5NO3S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 444.87 |
| IUPAC Name | 2-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)acetyl chloride |
| SMILES | O=C(Cl)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H8Cl5NO3S/c15-8-2-4-12(11(18)5-8)20(7-14(19)21)24(22,23)13-6-9(16)1-3-10(13)17/h1-6H,7H2 |
| InChIKey | VZWVDVDLDPGCTB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|