C16H13Cl4NO4S — CID 50892700
4-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)butanoic acid (PubChem CID 50892700) has the molecular formula C16H13Cl4NO4S and a molecular weight of 457.16 g/mol. Its IUPAC name is 4-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50892700 |
| Molecular Formula | C16H13Cl4NO4S |
| Molecular Weight | 457.16 g/mol |
| Exact Mass | 454.93 |
| IUPAC Name | 4-(2,4-dichloro-N-(2,5-dichlorophenyl)sulfonylanilino)butanoic acid |
| SMILES | O=C(O)CCCN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl4NO4S/c17-10-4-6-14(13(20)8-10)21(7-1-2-16(22)23)26(24,25)15-9-11(18)3-5-12(15)19/h3-6,8-9H,1-2,7H2,(H,22,23) |
| InChIKey | WSFRFBJALGHXOG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.16 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |