C15H10Cl3NO6S — CID 50894659
5-[carboxymethyl-(2,5-dichlorophenyl)sulfonylamino]-2-chlorobenzoic acid (PubChem CID 50894659) has the molecular formula C15H10Cl3NO6S and a molecular weight of 438.67 g/mol. Its IUPAC name is 5-[carboxymethyl-(2,5-dichlorophenyl)sulfonylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[carboxymethyl-(2,5-dichlorophenyl)sulfonylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 50894659 |
| Molecular Formula | C15H10Cl3NO6S |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | 5-[carboxymethyl-(2,5-dichlorophenyl)sulfonylamino]-2-chlorobenzoic acid |
| SMILES | O=C(O)CN(c1ccc(Cl)c(C(=O)O)c1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H10Cl3NO6S/c16-8-1-3-12(18)13(5-8)26(24,25)19(7-14(20)21)9-2-4-11(17)10(6-9)15(22)23/h1-6H,7H2,(H,20,21)(H,22,23) |
| InChIKey | AXMDCUZPRBKXDF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |