C17H16Cl3NO4S — CID 100509655
ethyl 2-chloro-5-[(2,5-dichlorophenyl)sulfonyl-ethylamino]benzoate (PubChem CID 100509655) has the molecular formula C17H16Cl3NO4S and a molecular weight of 436.74 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(2,5-dichlorophenyl)sulfonyl-ethylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(2,5-dichlorophenyl)sulfonyl-ethylamino]benzoate |
|---|---|
| PubChem CID | 100509655 |
| Molecular Formula | C17H16Cl3NO4S |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | ethyl 2-chloro-5-[(2,5-dichlorophenyl)sulfonyl-ethylamino]benzoate |
| SMILES | CCOC(=O)c1cc(N(CC)S(=O)(=O)c2cc(Cl)ccc2Cl)ccc1Cl |
| InChI | InChI=1S/C17H16Cl3NO4S/c1-3-21(26(23,24)16-9-11(18)5-7-15(16)20)12-6-8-14(19)13(10-12)17(22)25-4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | MITSOZWXWLCMIA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |