C16H14Cl3NO4S — CID 100509678
ethyl 2-chloro-4-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate (PubChem CID 100509678) has the molecular formula C16H14Cl3NO4S and a molecular weight of 422.72 g/mol. Its IUPAC name is ethyl 2-chloro-4-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate |
|---|---|
| PubChem CID | 100509678 |
| Molecular Formula | C16H14Cl3NO4S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | ethyl 2-chloro-4-[(2,5-dichlorophenyl)sulfonyl-methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(C)S(=O)(=O)c2cc(Cl)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl3NO4S/c1-3-24-16(21)12-6-5-11(9-14(12)19)20(2)25(22,23)15-8-10(17)4-7-13(15)18/h4-9H,3H2,1-2H3 |
| InChIKey | WQMWXBYRFCXCKJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |