C17H17Cl2N3O2 — CID 91723981
ethyl 2-[(2,5-dichlorophenyl)diazenyl]-5-(dimethylamino)benzoate (PubChem CID 91723981) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is ethyl 2-[(2,5-dichlorophenyl)diazenyl]-5-(dimethylamino)benzoate.
| Compound Name | ethyl 2-[(2,5-dichlorophenyl)diazenyl]-5-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 91723981 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | ethyl 2-[(2,5-dichlorophenyl)diazenyl]-5-(dimethylamino)benzoate |
| SMILES | CCOC(=O)c1cc(N(C)C)ccc1/N=N/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-4-24-17(23)13-10-12(22(2)3)6-8-15(13)20-21-16-9-11(18)5-7-14(16)19/h5-10H,4H2,1-3H3/b21-20+ |
| InChIKey | YIGQMBIVVTUELF-QZQOTICOSA-N |
| XLogP | 5.65 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|