C12H9Cl2F3N2O3 — CID 135466353
ethyl (Z)-2-[(2,5-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate (PubChem CID 135466353) has the molecular formula C12H9Cl2F3N2O3 and a molecular weight of 357.12 g/mol. Its IUPAC name is ethyl (Z)-2-[(2,5-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-[(2,5-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135466353 |
| Molecular Formula | C12H9Cl2F3N2O3 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | ethyl (Z)-2-[(2,5-dichlorophenyl)diazenyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1cc(Cl)ccc1Cl)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C12H9Cl2F3N2O3/c1-2-22-11(21)9(10(20)12(15,16)17)19-18-8-5-6(13)3-4-7(8)14/h3-5,20H,2H2,1H3/b10-9-,19-18+ |
| InChIKey | FWNBGESIMCHWDW-HFTJRMBSSA-N |
| XLogP | 4.97 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|