C12H10F3N3O5 — CID 135526846
ethyl (Z)-4,4,4-trifluoro-3-hydroxy-2-[(4-nitrophenyl)diazenyl]but-2-enoate (PubChem CID 135526846) has the molecular formula C12H10F3N3O5 and a molecular weight of 333.22 g/mol. Its IUPAC name is ethyl (Z)-4,4,4-trifluoro-3-hydroxy-2-[(4-nitrophenyl)diazenyl]but-2-enoate.
| Compound Name | ethyl (Z)-4,4,4-trifluoro-3-hydroxy-2-[(4-nitrophenyl)diazenyl]but-2-enoate |
|---|---|
| PubChem CID | 135526846 |
| Molecular Formula | C12H10F3N3O5 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | ethyl (Z)-4,4,4-trifluoro-3-hydroxy-2-[(4-nitrophenyl)diazenyl]but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc([N+](=O)[O-])cc1)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O5/c1-2-23-11(20)9(10(19)12(13,14)15)17-16-7-3-5-8(6-4-7)18(21)22/h3-6,19H,2H2,1H3/b10-9-,17-16+ |
| InChIKey | WXBFOCQEULLKTQ-WXYFSRDHSA-N |
| XLogP | 3.57 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|