C18H14F3N3O5S — CID 135469848
ethyl (E)-3-hydroxy-3-(4-nitrophenyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]diazenyl]prop-2-enoate (PubChem CID 135469848) has the molecular formula C18H14F3N3O5S and a molecular weight of 441.39 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-3-(4-nitrophenyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]diazenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-3-(4-nitrophenyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]diazenyl]prop-2-enoate |
|---|---|
| PubChem CID | 135469848 |
| Molecular Formula | C18H14F3N3O5S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | ethyl (E)-3-hydroxy-3-(4-nitrophenyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]diazenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1ccc(SC(F)(F)F)cc1)=C(\O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H14F3N3O5S/c1-2-29-17(26)15(16(25)11-3-7-13(8-4-11)24(27)28)23-22-12-5-9-14(10-6-12)30-18(19,20)21/h3-10,25H,2H2,1H3/b16-15+,23-22+ |
| InChIKey | RQFUVZJOGRDYMH-ALFBEORRSA-N |
| XLogP | 5.78 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|