C16H9BrF3N3O4 — CID 135429787
(E)-4-(4-bromophenyl)-1,1,1-trifluoro-4-hydroxy-3-[(4-nitrophenyl)diazenyl]but-3-en-2-one (PubChem CID 135429787) has the molecular formula C16H9BrF3N3O4 and a molecular weight of 444.16 g/mol. Its IUPAC name is (E)-4-(4-bromophenyl)-1,1,1-trifluoro-4-hydroxy-3-[(4-nitrophenyl)diazenyl]but-3-en-2-one.
| Compound Name | (E)-4-(4-bromophenyl)-1,1,1-trifluoro-4-hydroxy-3-[(4-nitrophenyl)diazenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 135429787 |
| Molecular Formula | C16H9BrF3N3O4 |
| Molecular Weight | 444.16 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | (E)-4-(4-bromophenyl)-1,1,1-trifluoro-4-hydroxy-3-[(4-nitrophenyl)diazenyl]but-3-en-2-one |
| SMILES | O=C(C(/N=N/c1ccc([N+](=O)[O-])cc1)=C(\O)c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H9BrF3N3O4/c17-10-3-1-9(2-4-10)14(24)13(15(25)16(18,19)20)22-21-11-5-7-12(8-6-11)23(26)27/h1-8,24H/b14-13+,22-21+ |
| InChIKey | CGZUNBLDDISULF-YTHQKGAESA-N |
| XLogP | 5.50 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|