C16H11F4N3O4S — CID 135882946
4-[[4,4,4-trifluoro-1-(4-fluorophenyl)-1-hydroxy-3-oxobut-1-en-2-yl]diazenyl]benzenesulfonamide (PubChem CID 135882946) has the molecular formula C16H11F4N3O4S and a molecular weight of 417.34 g/mol. Its IUPAC name is 4-[[4,4,4-trifluoro-1-(4-fluorophenyl)-1-hydroxy-3-oxobut-1-en-2-yl]diazenyl]benzenesulfonamide.
| Compound Name | 4-[[4,4,4-trifluoro-1-(4-fluorophenyl)-1-hydroxy-3-oxobut-1-en-2-yl]diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135882946 |
| Molecular Formula | C16H11F4N3O4S |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 4-[[4,4,4-trifluoro-1-(4-fluorophenyl)-1-hydroxy-3-oxobut-1-en-2-yl]diazenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=N/C(C(=O)C(F)(F)F)=C(O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H11F4N3O4S/c17-10-3-1-9(2-4-10)14(24)13(15(25)16(18,19)20)23-22-11-5-7-12(8-6-11)28(21,26)27/h1-8,24H,(H2,21,26,27)/b14-13?,23-22+ |
| InChIKey | GOTGEVMBYPZDHF-YUSATPKCSA-N |
| XLogP | 3.62 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|